C16H14ClNO3 — CID 101254063
[(S)-[5-(2-chlorophenyl)furan-2-yl]-cyanomethyl] butanoate (PubChem CID 101254063) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is [(S)-[5-(2-chlorophenyl)furan-2-yl]-cyanomethyl] butanoate.
| Compound Name | [(S)-[5-(2-chlorophenyl)furan-2-yl]-cyanomethyl] butanoate |
|---|---|
| PubChem CID | 101254063 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [(S)-[5-(2-chlorophenyl)furan-2-yl]-cyanomethyl] butanoate |
| SMILES | CCCC(=O)O[C@@H](C#N)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C16H14ClNO3/c1-2-5-16(19)21-15(10-18)14-9-8-13(20-14)11-6-3-4-7-12(11)17/h3-4,6-9,15H,2,5H2,1H3/t15-/m0/s1 |
| InChIKey | YYTWOQFMKRBOPH-HNNXBMFYSA-N |
| XLogP | 4.51 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |