C16H13NO2 — CID 101254224
(1R)-9-oxa-11-azatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-12-one (PubChem CID 101254224) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is (1R)-9-oxa-11-azatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-12-one.
| Compound Name | (1R)-9-oxa-11-azatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-12-one |
|---|---|
| PubChem CID | 101254224 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (1R)-9-oxa-11-azatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-12-one |
| SMILES | O=C1c2ccccc2[C@H]2c3ccccc3COCN12 |
| InChI | InChI=1S/C16H13NO2/c18-16-14-8-4-3-7-13(14)15-12-6-2-1-5-11(12)9-19-10-17(15)16/h1-8,15H,9-10H2/t15-/m1/s1 |
| InChIKey | PYIQAZYUYUXLLU-OAHLLOKOSA-N |
| XLogP | 2.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |