C18H17FO2 — CID 10125435
[(2S,4S,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methanol (PubChem CID 10125435) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is [(2S,4S,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methanol.
| Compound Name | [(2S,4S,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methanol |
|---|---|
| PubChem CID | 10125435 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [(2S,4S,6S)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methanol |
| SMILES | OC[C@@H]1C[C@H]2c3ccccc3Cc3ccc(F)cc3[C@H]2O1 |
| InChI | InChI=1S/C18H17FO2/c19-13-6-5-12-7-11-3-1-2-4-15(11)17-9-14(10-20)21-18(17)16(12)8-13/h1-6,8,14,17-18,20H,7,9-10H2/t14-,17-,18+/m0/s1 |
| InChIKey | KTNABMDPVANEBV-JCGIZDLHSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |