C18H13F5O2 — CID 101254577
[(E,2R)-4-phenylpent-3-en-2-yl] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 101254577) has the molecular formula C18H13F5O2 and a molecular weight of 356.29 g/mol. Its IUPAC name is [(E,2R)-4-phenylpent-3-en-2-yl] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(E,2R)-4-phenylpent-3-en-2-yl] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 101254577 |
| Molecular Formula | C18H13F5O2 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [(E,2R)-4-phenylpent-3-en-2-yl] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C/C(=C\[C@@H](C)OC(=O)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C18H13F5O2/c1-9(11-6-4-3-5-7-11)8-10(2)25-18(24)12-13(19)15(21)17(23)16(22)14(12)20/h3-8,10H,1-2H3/b9-8+/t10-/m1/s1 |
| InChIKey | KGVRCUCZDYMHDM-AAXQSMANSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|