About (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile (PubChem CID 101254719) has the molecular formula C13H21NOSi
and a molecular weight of 235.40 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile.
Molecular Properties
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile |
| PubChem CID | 101254719 |
| Molecular Formula | C13H21NOSi |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C#N)C1=CC=CC1 |
| InChI | InChI=1S/C13H21NOSi/c1-13(2,3)16(4,5)15-12(10-14)11-8-6-7-9-11/h6-8,12H,9H2,1-5H3/t12-/m0/s1 |
| InChIKey | POQBYRWFBNSDTK-LBPRGKRZSA-N |
| XLogP | 3.79 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile?
The IUPAC name of (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile (CID 101254719) is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile.
What is the SMILES notation for (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile?
The canonical SMILES for (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile is CC(C)(C)[Si](C)(C)O[C@@H](C#N)C1=CC=CC1.
What is the InChIKey of (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile?
The InChIKey is POQBYRWFBNSDTK-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H21NOSi/c1-13(2,3)16(4,5)15-12(10-14)11-8-6-7-9-11/h6-8,12H,9H2,1-5H3/t12-/m0/s1.
What are the key properties of (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile?
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile has a molecular weight of 235.40 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopenta-1,3-dien-1-ylacetonitrile is sourced from PubChem (CID 101254719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).