C20H20ClNO3 — CID 101254876
methyl 1-(4-chlorophenyl)-4-(cyclohexen-1-yl)-5-methyl-6-oxopyridine-3-carboxylate (PubChem CID 101254876) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is methyl 1-(4-chlorophenyl)-4-(cyclohexen-1-yl)-5-methyl-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-(4-chlorophenyl)-4-(cyclohexen-1-yl)-5-methyl-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 101254876 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl 1-(4-chlorophenyl)-4-(cyclohexen-1-yl)-5-methyl-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cn(-c2ccc(Cl)cc2)c(=O)c(C)c1C1=CCCCC1 |
| InChI | InChI=1S/C20H20ClNO3/c1-13-18(14-6-4-3-5-7-14)17(20(24)25-2)12-22(19(13)23)16-10-8-15(21)9-11-16/h6,8-12H,3-5,7H2,1-2H3 |
| InChIKey | FBLSEERDENFJMK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |