C12H16O — CID 101254941
(5S,7aS)-7a-prop-2-ynyl-1,2,3,5,6,7-hexahydroinden-5-ol (PubChem CID 101254941) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (5S,7aS)-7a-prop-2-ynyl-1,2,3,5,6,7-hexahydroinden-5-ol.
| Compound Name | (5S,7aS)-7a-prop-2-ynyl-1,2,3,5,6,7-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 101254941 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (5S,7aS)-7a-prop-2-ynyl-1,2,3,5,6,7-hexahydroinden-5-ol |
| SMILES | C#CC[C@@]12CCCC1=C[C@@H](O)CC2 |
| InChI | InChI=1S/C12H16O/c1-2-6-12-7-3-4-10(12)9-11(13)5-8-12/h1,9,11,13H,3-8H2/t11-,12-/m0/s1 |
| InChIKey | IBMNQWCZKNURIZ-RYUDHWBXSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|