About diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate
diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate (PubChem CID 101255348) has the molecular formula C13H18O6
and a molecular weight of 270.28 g/mol. Its IUPAC name is diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate |
| PubChem CID | 101255348 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(OC)C(OC)=C(C(=O)OCC)C1 |
| InChI | InChI=1S/C13H18O6/c1-5-18-12(14)8-7-9(13(15)19-6-2)11(17-4)10(8)16-3/h5-7H2,1-4H3 |
| InChIKey | YQAKKDWSNUZJFW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate?
The IUPAC name of diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate (CID 101255348) is diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate.
What is the SMILES notation for diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate?
The canonical SMILES for diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate is CCOC(=O)C1=C(OC)C(OC)=C(C(=O)OCC)C1.
What is the InChIKey of diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate?
The InChIKey is YQAKKDWSNUZJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O6/c1-5-18-12(14)8-7-9(13(15)19-6-2)11(17-4)10(8)16-3/h5-7H2,1-4H3.
What are the key properties of diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate?
diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate has a molecular weight of 270.28 g/mol, XLogP of 1.32, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4,5-dimethoxycyclopenta-3,5-diene-1,3-dicarboxylate is sourced from PubChem (CID 101255348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).