About 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one
1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one (PubChem CID 101255497) has the molecular formula C16H21N5O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one |
| PubChem CID | 101255497 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one |
| SMILES | CC(C)(C)[C@H](CC(=O)N1CCN(c2ccccc2)C1=O)N=[N+]=[N-] |
| InChI | InChI=1S/C16H21N5O2/c1-16(2,3)13(18-19-17)11-14(22)21-10-9-20(15(21)23)12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | BQKVZTZMPXDDCJ-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one?
The IUPAC name of 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one (CID 101255497) is 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one.
What is the SMILES notation for 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one?
The canonical SMILES for 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one is CC(C)(C)[C@H](CC(=O)N1CCN(c2ccccc2)C1=O)N=[N+]=[N-].
What is the InChIKey of 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one?
The InChIKey is BQKVZTZMPXDDCJ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H21N5O2/c1-16(2,3)13(18-19-17)11-14(22)21-10-9-20(15(21)23)12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3/t13-/m0/s1.
What are the key properties of 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one?
1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one has a molecular weight of 315.38 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3-azido-4,4-dimethylpentanoyl]-3-phenylimidazolidin-2-one is sourced from PubChem (CID 101255497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).