C10H13O2+ — CID 101255658
(3-methoxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)-methyloxidanium (PubChem CID 101255658) has the molecular formula C10H13O2+ and a molecular weight of 165.21 g/mol. Its IUPAC name is (3-methoxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)-methyloxidanium.
| Compound Name | (3-methoxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)-methyloxidanium |
|---|---|
| PubChem CID | 101255658 |
| Molecular Formula | C10H13O2+ |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (3-methoxy-4,6-dimethylidenecyclohex-2-en-1-ylidene)-methyloxidanium |
| SMILES | C=C1CC(=C)/C(=[O+]/C)C=C1OC |
| InChI | InChI=1S/C10H13O2/c1-7-5-8(2)10(12-4)6-9(7)11-3/h6H,1-2,5H2,3-4H3/q+1 |
| InChIKey | CANSEQZRHSMBQM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|