About [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate
[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate (PubChem CID 101255691) has the molecular formula C16H28O4Si
and a molecular weight of 312.48 g/mol. Its IUPAC name is [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate.
Molecular Properties
| Compound Name | [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate |
| PubChem CID | 101255691 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate |
| SMILES | C=COC(=O)O[C@H]1CCCC=C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O4Si/c1-7-18-15(17)20-14-11-9-8-10-13(14)12-19-21(5,6)16(2,3)4/h7,10,14H,1,8-9,11-12H2,2-6H3/t14-/m0/s1 |
| InChIKey | BASFDOPUQFBEBP-AWEZNQCLSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate?
The IUPAC name of [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate (CID 101255691) is [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate.
What is the SMILES notation for [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate?
The canonical SMILES for [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate is C=COC(=O)O[C@H]1CCCC=C1CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate?
The InChIKey is BASFDOPUQFBEBP-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H28O4Si/c1-7-18-15(17)20-14-11-9-8-10-13(14)12-19-21(5,6)16(2,3)4/h7,10,14H,1,8-9,11-12H2,2-6H3/t14-/m0/s1.
What are the key properties of [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate?
[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate has a molecular weight of 312.48 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate is sourced from PubChem (CID 101255691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).