C38H59NO3 — CID 101255828
[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-pyridin-4-yloxyhexanoate (PubChem CID 101255828) has the molecular formula C38H59NO3 and a molecular weight of 577.89 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-pyridin-4-yloxyhexanoate.
| Compound Name | [(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-pyridin-4-yloxyhexanoate |
|---|---|
| PubChem CID | 101255828 |
| Molecular Formula | C38H59NO3 |
| Molecular Weight | 577.89 g/mol |
| Exact Mass | 577.45 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-pyridin-4-yloxyhexanoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(OC(=O)CCCCCOc5ccncc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C38H59NO3/c1-27(2)10-9-11-28(3)33-15-16-34-32-14-13-29-26-31(17-21-37(29,4)35(32)18-22-38(33,34)5)42-36(40)12-7-6-8-25-41-30-19-23-39-24-20-30/h13,19-20,23-24,27-28,31-35H,6-12,14-18,21-22,25-26H2,1-5H3/t28-,31?,32+,33-,34+,35+,37+,38-/m1/s1 |
| InChIKey | ZQFOIDQVTRRRDE-MLXYAUDSSA-N |
| XLogP | 9.97 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.89 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|