C34H56O4 — CID 101255837
7-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-7-oxoheptanoic acid (PubChem CID 101255837) has the molecular formula C34H56O4 and a molecular weight of 528.82 g/mol. Its IUPAC name is 7-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-7-oxoheptanoic acid.
| Compound Name | 7-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 101255837 |
| Molecular Formula | C34H56O4 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | 7-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-7-oxoheptanoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(OC(=O)CCCCCC(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H56O4/c1-23(2)10-9-11-24(3)28-16-17-29-27-15-14-25-22-26(38-32(37)13-8-6-7-12-31(35)36)18-20-33(25,4)30(27)19-21-34(28,29)5/h14,23-24,26-30H,6-13,15-22H2,1-5H3,(H,35,36)/t24-,26?,27+,28-,29+,30+,33+,34-/m1/s1 |
| InChIKey | NOWFFSPLTPDGJO-JBGDPELASA-N |
| XLogP | 8.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|