C11H14O3 — CID 101257720
(3aR,6aS,7S,9aS)-7-hydroxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one (PubChem CID 101257720) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (3aR,6aS,7S,9aS)-7-hydroxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one.
| Compound Name | (3aR,6aS,7S,9aS)-7-hydroxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one |
|---|---|
| PubChem CID | 101257720 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (3aR,6aS,7S,9aS)-7-hydroxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one |
| SMILES | O=C1OC[C@@]23CC[C@H](O)[C@H]2C=CC[C@@H]13 |
| InChI | InChI=1S/C11H14O3/c12-9-4-5-11-6-14-10(13)8(11)3-1-2-7(9)11/h1-2,7-9,12H,3-6H2/t7-,8+,9+,11+/m1/s1 |
| InChIKey | SBBMMLBKCYRBKM-HJGDQZAQSA-N |
| XLogP | 0.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|