C17H28O3Si — CID 101257721
(3aS,6aR,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one (PubChem CID 101257721) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is (3aS,6aR,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one.
| Compound Name | (3aS,6aR,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one |
|---|---|
| PubChem CID | 101257721 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (3aS,6aR,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a,4,6a,7,8,9-hexahydro-1H-cyclopenta[d][2]benzofuran-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@]23COC(=O)[C@H]2CC=C[C@@H]13 |
| InChI | InChI=1S/C17H28O3Si/c1-16(2,3)21(4,5)20-14-9-10-17-11-19-15(18)13(17)8-6-7-12(14)17/h6-7,12-14H,8-11H2,1-5H3/t12-,13+,14-,17+/m0/s1 |
| InChIKey | DAVBGVBPLUGRQJ-QDEZUTFSSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|