C28H46O3 — CID 101258098
[(1R,2S,5R,6R,9S,10Z,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-15-oxo-13-tricyclo[7.7.0.02,6]hexadec-10-enyl] acetate (PubChem CID 101258098) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is [(1R,2S,5R,6R,9S,10Z,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-15-oxo-13-tricyclo[7.7.0.02,6]hexadec-10-enyl] acetate.
| Compound Name | [(1R,2S,5R,6R,9S,10Z,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-15-oxo-13-tricyclo[7.7.0.02,6]hexadec-10-enyl] acetate |
|---|---|
| PubChem CID | 101258098 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | [(1R,2S,5R,6R,9S,10Z,13S)-6,10-dimethyl-5-[(2R)-6-methylheptan-2-yl]-15-oxo-13-tricyclo[7.7.0.02,6]hexadec-10-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C/C=C(/C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]3[C@@H]2CC(=O)C1 |
| InChI | InChI=1S/C28H46O3/c1-18(2)8-7-9-20(4)26-12-13-27-25-17-22(30)16-23(31-21(5)29)11-10-19(3)24(25)14-15-28(26,27)6/h10,18,20,23-27H,7-9,11-17H2,1-6H3/b19-10-/t20-,23+,24-,25-,26-,27+,28-/m1/s1 |
| InChIKey | FSZWODPNMZAVAE-BMKYEPDYSA-N |
| XLogP | 7.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|