C25H25NO2 — CID 101258149
(3S,7aS)-3-(4-methoxyphenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 101258149) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is (3S,7aS)-3-(4-methoxyphenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (3S,7aS)-3-(4-methoxyphenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 101258149 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (3S,7aS)-3-(4-methoxyphenyl)-1,1-diphenyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | COc1ccc([C@@H]2OC(c3ccccc3)(c3ccccc3)[C@@H]3CCCN32)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-27-22-16-14-19(15-17-22)24-26-18-8-13-23(26)25(28-24,20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,14-17,23-24H,8,13,18H2,1H3/t23-,24-/m0/s1 |
| InChIKey | WCWAUHKUSLJWNE-ZEQRLZLVSA-N |
| XLogP | 5.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |