C19H22O5 — CID 10125816
(2S,3R,4R,5S,6R)-2-(3-benzylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10125816) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-(3-benzylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-(3-benzylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10125816 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-(3-benzylphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cccc(Cc3ccccc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H22O5/c20-11-15-16(21)17(22)18(23)19(24-15)14-8-4-7-13(10-14)9-12-5-2-1-3-6-12/h1-8,10,15-23H,9,11H2/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | SZHXKKDXIWLWAN-FQBWVUSXSA-N |
| XLogP | 0.79 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |