About 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane
4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane (PubChem CID 10125844) has the molecular formula C13H15FN8S
and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane.
Molecular Properties
| Compound Name | 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane |
| PubChem CID | 10125844 |
| Molecular Formula | C13H15FN8S |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane |
| SMILES | [H]N=S1CCN(c2ccc(-n3cc(CN=[N+]=[N-])nn3)cc2F)CC1 |
| InChI | InChI=1S/C13H15FN8S/c14-12-7-11(22-9-10(18-20-22)8-17-19-15)1-2-13(12)21-3-5-23(16)6-4-21/h1-2,7,9,16H,3-6,8H2 |
| InChIKey | SARUGPWLDJTBRR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane?
The IUPAC name of 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane (CID 10125844) is 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane.
What is the SMILES notation for 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane?
The canonical SMILES for 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane is [H]N=S1CCN(c2ccc(-n3cc(CN=[N+]=[N-])nn3)cc2F)CC1.
What is the InChIKey of 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane?
The InChIKey is SARUGPWLDJTBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN8S/c14-12-7-11(22-9-10(18-20-22)8-17-19-15)1-2-13(12)21-3-5-23(16)6-4-21/h1-2,7,9,16H,3-6,8H2.
What are the key properties of 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane?
4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane has a molecular weight of 334.38 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-(azidomethyl)triazol-1-yl]-2-fluorophenyl]-1-imino-1,4-thiazinane is sourced from PubChem (CID 10125844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).