C16H21NO3 — CID 101258458
methyl 2-[(3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridin-8a-yl]acetate (PubChem CID 101258458) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 2-[(3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridin-8a-yl]acetate.
| Compound Name | methyl 2-[(3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridin-8a-yl]acetate |
|---|---|
| PubChem CID | 101258458 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl 2-[(3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,2-a]pyridin-8a-yl]acetate |
| SMILES | COC(=O)C[C@@]12CCCCN1[C@@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C16H21NO3/c1-19-15(18)11-16-9-5-6-10-17(16)14(12-20-16)13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-12H2,1H3/t14-,16+/m1/s1 |
| InChIKey | WVWIKNAFBCTJRD-ZBFHGGJFSA-N |
| XLogP | 2.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |