C17H18F3NO3 — CID 10125925
(3aS,7aR)-3-hydroxy-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one (PubChem CID 10125925) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is (3aS,7aR)-3-hydroxy-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one.
| Compound Name | (3aS,7aR)-3-hydroxy-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one |
|---|---|
| PubChem CID | 10125925 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (3aS,7aR)-3-hydroxy-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindol-1-one |
| SMILES | CC12CCC(C)(O1)[C@H]1C(O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H18F3NO3/c1-15-6-7-16(2,24-15)12-11(15)13(22)21(14(12)23)10-5-3-4-9(8-10)17(18,19)20/h3-5,8,11-13,22H,6-7H2,1-2H3/t11-,12+,13?,15?,16?/m1/s1 |
| InChIKey | VXTQKHFIODYXMK-JMDWFWQOSA-N |
| XLogP | 2.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |