C20H26O6 — CID 101259804
7-(2-methoxyethoxymethoxy)-2,2-dimethyl-6-(3-methylbut-2-enyl)chromene-5,8-dione (PubChem CID 101259804) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 7-(2-methoxyethoxymethoxy)-2,2-dimethyl-6-(3-methylbut-2-enyl)chromene-5,8-dione.
| Compound Name | 7-(2-methoxyethoxymethoxy)-2,2-dimethyl-6-(3-methylbut-2-enyl)chromene-5,8-dione |
|---|---|
| PubChem CID | 101259804 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 7-(2-methoxyethoxymethoxy)-2,2-dimethyl-6-(3-methylbut-2-enyl)chromene-5,8-dione |
| SMILES | COCCOCOC1=C(CC=C(C)C)C(=O)C2=C(OC(C)(C)C=C2)C1=O |
| InChI | InChI=1S/C20H26O6/c1-13(2)6-7-14-16(21)15-8-9-20(3,4)26-19(15)17(22)18(14)25-12-24-11-10-23-5/h6,8-9H,7,10-12H2,1-5H3 |
| InChIKey | LARUOIUQAHLDSA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|