C15H18O3 — CID 101259978
(1S,2R,3R,7S)-8,8-dimethyl-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]oct-4-ene-3,4-dicarbaldehyde (PubChem CID 101259978) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1S,2R,3R,7S)-8,8-dimethyl-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]oct-4-ene-3,4-dicarbaldehyde.
| Compound Name | (1S,2R,3R,7S)-8,8-dimethyl-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]oct-4-ene-3,4-dicarbaldehyde |
|---|---|
| PubChem CID | 101259978 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1S,2R,3R,7S)-8,8-dimethyl-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]oct-4-ene-3,4-dicarbaldehyde |
| SMILES | C=C(C=O)[C@@H]1[C@@H]2[C@H](CC=C(C=O)[C@@H]1C=O)C2(C)C |
| InChI | InChI=1S/C15H18O3/c1-9(6-16)13-11(8-18)10(7-17)4-5-12-14(13)15(12,2)3/h4,6-8,11-14H,1,5H2,2-3H3/t11-,12-,13-,14-/m0/s1 |
| InChIKey | SCQAWIJMLAWHOZ-XUXIUFHCSA-N |
| XLogP | 1.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|