C39H57N4O5+3 — CID 101260160
3-[bis(3-azaniumylpropyl)amino]propyl-[[10-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl)anthracen-9-yl]methyl]azanium (PubChem CID 101260160) has the molecular formula C39H57N4O5+3 and a molecular weight of 661.91 g/mol. Its IUPAC name is 3-[bis(3-azaniumylpropyl)amino]propyl-[[10-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl)anthracen-9-yl]methyl]azanium.
| Compound Name | 3-[bis(3-azaniumylpropyl)amino]propyl-[[10-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl)anthracen-9-yl]methyl]azanium |
|---|---|
| PubChem CID | 101260160 |
| Molecular Formula | C39H57N4O5+3 |
| Molecular Weight | 661.91 g/mol |
| Exact Mass | 661.43 |
| IUPAC Name | 3-[bis(3-azaniumylpropyl)amino]propyl-[[10-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylmethyl)anthracen-9-yl]methyl]azanium |
| SMILES | [NH3+]CCCN(CCC[NH3+])CCC[NH2+]Cc1c2ccccc2c(Cc2ccc3c(c2)OCCOCCOCCOCCO3)c2ccccc12 |
| InChI | InChI=1S/C39H54N4O5/c40-14-5-17-43(18-6-15-41)19-7-16-42-30-37-34-10-3-1-8-32(34)36(33-9-2-4-11-35(33)37)28-31-12-13-38-39(29-31)48-27-25-46-23-21-44-20-22-45-24-26-47-38/h1-4,8-13,29,42H,5-7,14-28,30,40-41H2/p+3 |
| InChIKey | KSQOTRUXFGVRNP-UHFFFAOYSA-Q |
| XLogP | 2.42 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.91 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|