C20H14N2O2S — CID 101260286
(11R,15S,16R)-12-oxo-16-phenyl-13-oxa-8-thia-1-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraene-10-carbonitrile (PubChem CID 101260286) has the molecular formula C20H14N2O2S and a molecular weight of 346.41 g/mol. Its IUPAC name is (11R,15S,16R)-12-oxo-16-phenyl-13-oxa-8-thia-1-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraene-10-carbonitrile.
| Compound Name | (11R,15S,16R)-12-oxo-16-phenyl-13-oxa-8-thia-1-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraene-10-carbonitrile |
|---|---|
| PubChem CID | 101260286 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (11R,15S,16R)-12-oxo-16-phenyl-13-oxa-8-thia-1-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9-tetraene-10-carbonitrile |
| SMILES | N#CC1=C2Sc3ccccc3N2[C@@H](c2ccccc2)[C@H]2COC(=O)[C@@H]12 |
| InChI | InChI=1S/C20H14N2O2S/c21-10-13-17-14(11-24-20(17)23)18(12-6-2-1-3-7-12)22-15-8-4-5-9-16(15)25-19(13)22/h1-9,14,17-18H,11H2/t14-,17-,18-/m0/s1 |
| InChIKey | MNCQFQOCEWTPCF-WBAXXEDZSA-N |
| XLogP | 3.88 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |