C9H14O4 — CID 101260546
(4aR,5R,7S,7aR)-5,7-dihydroxy-7-methyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one (PubChem CID 101260546) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (4aR,5R,7S,7aR)-5,7-dihydroxy-7-methyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one.
| Compound Name | (4aR,5R,7S,7aR)-5,7-dihydroxy-7-methyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 101260546 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (4aR,5R,7S,7aR)-5,7-dihydroxy-7-methyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one |
| SMILES | C[C@]1(O)C[C@@H](O)[C@@H]2CC(=O)OC[C@@H]21 |
| InChI | InChI=1S/C9H14O4/c1-9(12)3-7(10)5-2-8(11)13-4-6(5)9/h5-7,10,12H,2-4H2,1H3/t5-,6+,7-,9+/m1/s1 |
| InChIKey | LKZXAOPEOQRJLJ-AYHNYZOXSA-N |
| XLogP | -0.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |