C22H16S4 — CID 101260755
2-[(2E,4E,6E)-8-(1,3-benzodithiol-2-ylidene)octa-2,4,6-trienylidene]-1,3-benzodithiole (PubChem CID 101260755) has the molecular formula C22H16S4 and a molecular weight of 408.64 g/mol. Its IUPAC name is 2-[(2E,4E,6E)-8-(1,3-benzodithiol-2-ylidene)octa-2,4,6-trienylidene]-1,3-benzodithiole.
| Compound Name | 2-[(2E,4E,6E)-8-(1,3-benzodithiol-2-ylidene)octa-2,4,6-trienylidene]-1,3-benzodithiole |
|---|---|
| PubChem CID | 101260755 |
| Molecular Formula | C22H16S4 |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-[(2E,4E,6E)-8-(1,3-benzodithiol-2-ylidene)octa-2,4,6-trienylidene]-1,3-benzodithiole |
| SMILES | C(/C=C/C=C/C=C/C=C1Sc2ccccc2S1)=C1Sc2ccccc2S1 |
| InChI | InChI=1S/C22H16S4/c1(3-5-15-21-23-17-11-7-8-12-18(17)24-21)2-4-6-16-22-25-19-13-9-10-14-20(19)26-22/h1-16H/b2-1+,5-3+,6-4+ |
| InChIKey | IKHLFLQUMKVYIL-CRQXNEITSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|