C18H17F13O5 — CID 101261242
diethyl 3-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)cyclopentane-1,1-dicarboxylate (PubChem CID 101261242) has the molecular formula C18H17F13O5 and a molecular weight of 560.30 g/mol. Its IUPAC name is diethyl 3-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101261242 |
| Molecular Formula | C18H17F13O5 |
| Molecular Weight | 560.30 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | diethyl 3-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(=O)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H17F13O5/c1-3-35-10(33)12(11(34)36-4-2)5-8(9(32)7-12)6-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h8H,3-7H2,1-2H3 |
| InChIKey | RULZRYNUUXTIQM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|