C16H10N8 — CID 101261268
pteridino[7,6-f][1,10]phenanthroline-11,13-diamine (PubChem CID 101261268) has the molecular formula C16H10N8 and a molecular weight of 314.31 g/mol. Its IUPAC name is pteridino[7,6-f][1,10]phenanthroline-11,13-diamine.
| Compound Name | pteridino[7,6-f][1,10]phenanthroline-11,13-diamine |
|---|---|
| PubChem CID | 101261268 |
| Molecular Formula | C16H10N8 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | pteridino[7,6-f][1,10]phenanthroline-11,13-diamine |
| SMILES | Nc1nc(N)c2nc3c4cccnc4c4ncccc4c3nc2n1 |
| InChI | InChI=1S/C16H10N8/c17-14-13-15(24-16(18)23-14)22-12-8-4-2-6-20-10(8)9-7(11(12)21-13)3-1-5-19-9/h1-6H,(H4,17,18,22,23,24) |
| InChIKey | XXFKVBZAJZDWND-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|