C16H22O8 — CID 101261477
(2R,3R,4aR,8Z,12aR)-8-ethenyl-2,3-dimethoxy-2,3-dimethyl-4a,7,10,12a-tetrahydro-[1,4]dioxino[2,3-c][1,6]dioxecine-5,12-dione (PubChem CID 101261477) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is (2R,3R,4aR,8Z,12aR)-8-ethenyl-2,3-dimethoxy-2,3-dimethyl-4a,7,10,12a-tetrahydro-[1,4]dioxino[2,3-c][1,6]dioxecine-5,12-dione.
| Compound Name | (2R,3R,4aR,8Z,12aR)-8-ethenyl-2,3-dimethoxy-2,3-dimethyl-4a,7,10,12a-tetrahydro-[1,4]dioxino[2,3-c][1,6]dioxecine-5,12-dione |
|---|---|
| PubChem CID | 101261477 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (2R,3R,4aR,8Z,12aR)-8-ethenyl-2,3-dimethoxy-2,3-dimethyl-4a,7,10,12a-tetrahydro-[1,4]dioxino[2,3-c][1,6]dioxecine-5,12-dione |
| SMILES | C=C/C1=C/COC(=O)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]2C(=O)OC1 |
| InChI | InChI=1S/C16H22O8/c1-6-10-7-8-21-13(17)11-12(14(18)22-9-10)24-16(3,20-5)15(2,19-4)23-11/h6-7,11-12H,1,8-9H2,2-5H3/b10-7-/t11-,12-,15-,16-/m1/s1 |
| InChIKey | VFVMYNSZTITULY-APVDCSEWSA-N |
| XLogP | 0.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |