C62H98O10 — CID 101262341
6-(3,4,5-triheptoxybenzoyl)oxyhexa-2,4-diynyl 3,4,5-triheptoxybenzoate (PubChem CID 101262341) has the molecular formula C62H98O10 and a molecular weight of 1003.46 g/mol. Its IUPAC name is 6-(3,4,5-triheptoxybenzoyl)oxyhexa-2,4-diynyl 3,4,5-triheptoxybenzoate.
| Compound Name | 6-(3,4,5-triheptoxybenzoyl)oxyhexa-2,4-diynyl 3,4,5-triheptoxybenzoate |
|---|---|
| PubChem CID | 101262341 |
| Molecular Formula | C62H98O10 |
| Molecular Weight | 1003.46 g/mol |
| Exact Mass | 1002.72 |
| IUPAC Name | 6-(3,4,5-triheptoxybenzoyl)oxyhexa-2,4-diynyl 3,4,5-triheptoxybenzoate |
| SMILES | CCCCCCCOc1cc(C(=O)OCC#CC#CCOC(=O)c2cc(OCCCCCCC)c(OCCCCCCC)c(OCCCCCCC)c2)cc(OCCCCCCC)c1OCCCCCCC |
| InChI | InChI=1S/C62H98O10/c1-7-13-19-25-33-41-65-55-49-53(50-56(66-42-34-26-20-14-8-2)59(55)69-45-37-29-23-17-11-5)61(63)71-47-39-31-32-40-48-72-62(64)54-51-57(67-43-35-27-21-15-9-3)60(70-46-38-30-24-18-12-6)58(52-54)68-44-36-28-22-16-10-4/h49-52H,7-30,33-38,41-48H2,1-6H3 |
| InChIKey | SMUHAPJFWLLTMV-UHFFFAOYSA-N |
| XLogP | 16.80 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.46 |
| LogP ≤ 5 | 16.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|