About 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine
8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine (PubChem CID 10126235) has the molecular formula C22H26N2OS
and a molecular weight of 366.53 g/mol. Its IUPAC name is 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine.
Molecular Properties
| Compound Name | 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine |
| PubChem CID | 10126235 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine |
| SMILES | COc1cccc2c1C(=C1CCN(C)CC1)c1ccc(N(C)C)cc1S2 |
| InChI | InChI=1S/C22H26N2OS/c1-23(2)16-8-9-17-20(14-16)26-19-7-5-6-18(25-4)22(19)21(17)15-10-12-24(3)13-11-15/h5-9,14H,10-13H2,1-4H3 |
| InChIKey | YMTDTSKJKGAAPG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine?
The IUPAC name of 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine (CID 10126235) is 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine.
What is the SMILES notation for 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine?
The canonical SMILES for 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine is COc1cccc2c1C(=C1CCN(C)CC1)c1ccc(N(C)C)cc1S2.
What is the InChIKey of 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine?
The InChIKey is YMTDTSKJKGAAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2OS/c1-23(2)16-8-9-17-20(14-16)26-19-7-5-6-18(25-4)22(19)21(17)15-10-12-24(3)13-11-15/h5-9,14H,10-13H2,1-4H3.
What are the key properties of 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine?
8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine has a molecular weight of 366.53 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-N,N-dimethyl-9-(1-methylpiperidin-4-ylidene)thioxanthen-3-amine is sourced from PubChem (CID 10126235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).