C15H23NO4 — CID 101262435
methyl (2Z,6Z,12E)-13-nitrotetradeca-2,6,12-trienoate (PubChem CID 101262435) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl (2Z,6Z,12E)-13-nitrotetradeca-2,6,12-trienoate.
| Compound Name | methyl (2Z,6Z,12E)-13-nitrotetradeca-2,6,12-trienoate |
|---|---|
| PubChem CID | 101262435 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | methyl (2Z,6Z,12E)-13-nitrotetradeca-2,6,12-trienoate |
| SMILES | COC(=O)/C=C\CC/C=C\CCCC/C=C(\C)[N+](=O)[O-] |
| InChI | InChI=1S/C15H23NO4/c1-14(16(18)19)12-10-8-6-4-3-5-7-9-11-13-15(17)20-2/h3,5,11-13H,4,6-10H2,1-2H3/b5-3-,13-11-,14-12+ |
| InChIKey | VSKQJUVFDZBQAO-UUNQGRHMSA-N |
| XLogP | 3.79 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|