C26H28O2Si — CID 101262811
tert-butyl-dimethyl-[[(13R,14R)-12-oxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,15,17,19-nonaen-14-yl]oxy]silane (PubChem CID 101262811) has the molecular formula C26H28O2Si and a molecular weight of 400.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(13R,14R)-12-oxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,15,17,19-nonaen-14-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(13R,14R)-12-oxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,15,17,19-nonaen-14-yl]oxy]silane |
|---|---|
| PubChem CID | 101262811 |
| Molecular Formula | C26H28O2Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(13R,14R)-12-oxapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,15,17,19-nonaen-14-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1c2ccccc2C=C2c3c(ccc4ccccc34)O[C@H]21 |
| InChI | InChI=1S/C26H28O2Si/c1-26(2,3)29(4,5)28-25-20-13-9-7-11-18(20)16-21-23-19-12-8-6-10-17(19)14-15-22(23)27-24(21)25/h6-16,24-25H,1-5H3/t24-,25-/m1/s1 |
| InChIKey | GDBVIRKIIXQWTM-JWQCQUIFSA-N |
| XLogP | 7.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|