C20H44O5Si2 — CID 101263209
(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-diethoxybutanal (PubChem CID 101263209) has the molecular formula C20H44O5Si2 and a molecular weight of 420.74 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-diethoxybutanal.
| Compound Name | (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-diethoxybutanal |
|---|---|
| PubChem CID | 101263209 |
| Molecular Formula | C20H44O5Si2 |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-diethoxybutanal |
| SMILES | CCOC(OCC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O5Si2/c1-13-22-18(23-14-2)17(25-27(11,12)20(6,7)8)16(15-21)24-26(9,10)19(3,4)5/h15-18H,13-14H2,1-12H3/t16-,17+/m0/s1 |
| InChIKey | KPTKAVDNYHWFPZ-DLBZAZTESA-N |
| XLogP | 5.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|