C31H32N4O3S3 — CID 101263599
3-(pyren-1-ylmethyl)-10,13,16-trioxa-20λ4-thia-1,5,7,19-tetrazatetracyclo[17.2.1.05,21.07,20]docos-20-ene-6,22-dithione (PubChem CID 101263599) has the molecular formula C31H32N4O3S3 and a molecular weight of 604.82 g/mol. Its IUPAC name is 3-(pyren-1-ylmethyl)-10,13,16-trioxa-20λ4-thia-1,5,7,19-tetrazatetracyclo[17.2.1.05,21.07,20]docos-20-ene-6,22-dithione.
| Compound Name | 3-(pyren-1-ylmethyl)-10,13,16-trioxa-20λ4-thia-1,5,7,19-tetrazatetracyclo[17.2.1.05,21.07,20]docos-20-ene-6,22-dithione |
|---|---|
| PubChem CID | 101263599 |
| Molecular Formula | C31H32N4O3S3 |
| Molecular Weight | 604.82 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 3-(pyren-1-ylmethyl)-10,13,16-trioxa-20λ4-thia-1,5,7,19-tetrazatetracyclo[17.2.1.05,21.07,20]docos-20-ene-6,22-dithione |
| SMILES | S=C1N2CC(Cc3ccc4ccc5cccc6ccc3c4c56)CN3C(=S)N4CCOCCOCCOCCN1S4=C23 |
| InChI | InChI=1S/C31H32N4O3S3/c39-29-32-19-21(18-25-7-6-24-5-4-22-2-1-3-23-8-9-26(25)28(24)27(22)23)20-33-30(40)35-11-13-37-15-17-38-16-14-36-12-10-34(29)41(35)31(32)33/h1-9,21H,10-20H2 |
| InChIKey | KGNZEOJSLJRWIZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|