About [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate
[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate (PubChem CID 10126363) has the molecular formula C14H16F2N4O4S
and a molecular weight of 374.37 g/mol. Its IUPAC name is [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate |
| PubChem CID | 10126363 |
| Molecular Formula | C14H16F2N4O4S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cn(-c2cc(F)c(N3CCOCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C14H16F2N4O4S/c1-25(21,22)24-9-10-8-20(18-17-10)11-6-12(15)14(13(16)7-11)19-2-4-23-5-3-19/h6-8H,2-5,9H2,1H3 |
| InChIKey | ZZMBATLOKBQOIA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate?
The IUPAC name of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate (CID 10126363) is [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate.
What is the SMILES notation for [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate?
The canonical SMILES for [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate is CS(=O)(=O)OCc1cn(-c2cc(F)c(N3CCOCC3)c(F)c2)nn1.
What is the InChIKey of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate?
The InChIKey is ZZMBATLOKBQOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N4O4S/c1-25(21,22)24-9-10-8-20(18-17-10)11-6-12(15)14(13(16)7-11)19-2-4-23-5-3-19/h6-8H,2-5,9H2,1H3.
What are the key properties of [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate?
[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate has a molecular weight of 374.37 g/mol, XLogP of 0.86, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate is sourced from PubChem (CID 10126363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).