C20H32O4 — CID 101264017
[(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate (PubChem CID 101264017) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101264017 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\[C@@H](C)[C@H]1O[C@]2(C)CC=C[C@@H](O2)[C@@H]1C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H32O4/c1-13(12-22-18(21)19(4,5)6)11-14(2)17-15(3)16-9-8-10-20(7,23-16)24-17/h8-9,11,14-17H,10,12H2,1-7H3/b13-11+/t14-,15+,16-,17-,20-/m1/s1 |
| InChIKey | HLLJICNOEFDBNK-VDTMLHPYSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|