C21H33BrO5 — CID 101264018
[(E,4R)-4-[(1S,3R,4R,5S,6R)-6-bromo-8-(hydroxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate (PubChem CID 101264018) has the molecular formula C21H33BrO5 and a molecular weight of 445.39 g/mol. Its IUPAC name is [(E,4R)-4-[(1S,3R,4R,5S,6R)-6-bromo-8-(hydroxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,4R)-4-[(1S,3R,4R,5S,6R)-6-bromo-8-(hydroxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101264018 |
| Molecular Formula | C21H33BrO5 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(E,4R)-4-[(1S,3R,4R,5S,6R)-6-bromo-8-(hydroxymethyl)-1,4-dimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\[C@@H](C)[C@H]1O[C@@]2(C)O[C@@H]([C@@H]1C)[C@H](Br)C=C2CO)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H33BrO5/c1-12(11-25-19(24)20(4,5)6)8-13(2)17-14(3)18-16(22)9-15(10-23)21(7,26-17)27-18/h8-9,13-14,16-18,23H,10-11H2,1-7H3/b12-8+/t13-,14-,16-,17-,18+,21+/m1/s1 |
| InChIKey | FJRMAAGJCQXYKR-QHWFCTCUSA-N |
| XLogP | 3.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|