C27H25NO4 — CID 101264645
[(2R)-2-[(2R)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidin-1-yl]-2-phenylethyl] benzoate (PubChem CID 101264645) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is [(2R)-2-[(2R)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidin-1-yl]-2-phenylethyl] benzoate.
| Compound Name | [(2R)-2-[(2R)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidin-1-yl]-2-phenylethyl] benzoate |
|---|---|
| PubChem CID | 101264645 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [(2R)-2-[(2R)-2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidin-1-yl]-2-phenylethyl] benzoate |
| SMILES | O=C(OC[C@@H](c1ccccc1)N1CCC[C@@H]1[C@H]1OC(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c29-26(20-12-5-2-6-13-20)31-18-24(19-10-3-1-4-11-19)28-17-9-16-23(28)25-21-14-7-8-15-22(21)27(30)32-25/h1-8,10-15,23-25H,9,16-18H2/t23-,24+,25+/m1/s1 |
| InChIKey | RXVPCICDGKCBMM-DSITVLBTSA-N |
| XLogP | 4.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |