About 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium
1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium (PubChem CID 101264748) has the molecular formula C16H17N2+
and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium.
Molecular Properties
| Compound Name | 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium |
| PubChem CID | 101264748 |
| Molecular Formula | C16H17N2+ |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium |
| SMILES | C[C@H](C1C=CC=C1)[n+]1ccn(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H17N2/c1-14(15-7-5-6-8-15)17-11-12-18(13-17)16-9-3-2-4-10-16/h2-15H,1H3/q+1/t14-/m1/s1 |
| InChIKey | ZRBHRSAFBFNALJ-CQSZACIVSA-N |
| XLogP | 3.07 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium?
The IUPAC name of 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium (CID 101264748) is 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium.
What is the SMILES notation for 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium?
The canonical SMILES for 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium is C[C@H](C1C=CC=C1)[n+]1ccn(-c2ccccc2)c1.
What is the InChIKey of 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium?
The InChIKey is ZRBHRSAFBFNALJ-CQSZACIVSA-N. The full InChI is InChI=1S/C16H17N2/c1-14(15-7-5-6-8-15)17-11-12-18(13-17)16-9-3-2-4-10-16/h2-15H,1H3/q+1/t14-/m1/s1.
What are the key properties of 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium?
1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium has a molecular weight of 237.33 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-cyclopenta-2,4-dien-1-ylethyl]-3-phenylimidazol-1-ium is sourced from PubChem (CID 101264748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).