About 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole
2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole (PubChem CID 10126516) has the molecular formula C20H19ClN2O2S
and a molecular weight of 386.90 g/mol. Its IUPAC name is 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 10126516 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole |
| SMILES | COCCOc1c(C2=NCCN2)cc2cc(-c3ccsc3)ccc2c1Cl |
| InChI | InChI=1S/C20H19ClN2O2S/c1-24-7-8-25-19-17(20-22-5-6-23-20)11-15-10-13(14-4-9-26-12-14)2-3-16(15)18(19)21/h2-4,9-12H,5-8H2,1H3,(H,22,23) |
| InChIKey | GGPHBJZRLRLIEM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole (CID 10126516) is 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole is COCCOc1c(C2=NCCN2)cc2cc(-c3ccsc3)ccc2c1Cl.
What is the InChIKey of 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole?
The InChIKey is GGPHBJZRLRLIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN2O2S/c1-24-7-8-25-19-17(20-22-5-6-23-20)11-15-10-13(14-4-9-26-12-14)2-3-16(15)18(19)21/h2-4,9-12H,5-8H2,1H3,(H,22,23).
What are the key properties of 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole?
2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole has a molecular weight of 386.90 g/mol, XLogP of 4.60, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-3-(2-methoxyethoxy)-7-thiophen-3-ylnaphthalen-2-yl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10126516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).