C17H24FNO2S — CID 101265629
2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine 3-oxide (PubChem CID 101265629) has the molecular formula C17H24FNO2S and a molecular weight of 325.45 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine 3-oxide.
| Compound Name | 2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine 3-oxide |
|---|---|
| PubChem CID | 101265629 |
| Molecular Formula | C17H24FNO2S |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine 3-oxide |
| SMILES | CC(C)(C)C1N=C(c2ccc(F)cc2)S(=O)C(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H24FNO2S/c1-16(2,3)14-19-13(11-7-9-12(18)10-8-11)22(20)15(21-14)17(4,5)6/h7-10,14-15H,1-6H3 |
| InChIKey | PPEJDTHDMYQBDW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |