C12H18F3NO2 — CID 101265636
tert-butyl (2S)-2-[(E)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 101265636) has the molecular formula C12H18F3NO2 and a molecular weight of 265.27 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101265636 |
| Molecular Formula | C12H18F3NO2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | tert-butyl (2S)-2-[(E)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1/C=C/C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO2/c1-11(2,3)18-10(17)16-8-4-5-9(16)6-7-12(13,14)15/h6-7,9H,4-5,8H2,1-3H3/b7-6+/t9-/m0/s1 |
| InChIKey | DQFLLUDPMXOTME-UCUJLANTSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|