C12H19F2NO3 — CID 101265821
2,2-difluoro-3-hydroxy-3-[(2S,3R)-3-propyloxiran-2-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 101265821) has the molecular formula C12H19F2NO3 and a molecular weight of 263.28 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-[(2S,3R)-3-propyloxiran-2-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2,2-difluoro-3-hydroxy-3-[(2S,3R)-3-propyloxiran-2-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 101265821 |
| Molecular Formula | C12H19F2NO3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-[(2S,3R)-3-propyloxiran-2-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CCC[C@H]1O[C@H]1C(O)C(F)(F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H19F2NO3/c1-2-5-8-9(18-8)10(16)12(13,14)11(17)15-6-3-4-7-15/h8-10,16H,2-7H2,1H3/t8-,9-,10?/m1/s1 |
| InChIKey | PHZDVJMNQRAGLA-MGRQHWMJSA-N |
| XLogP | 1.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|