C21H32O5Si — CID 10126601
(1S,2S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione (PubChem CID 10126601) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is (1S,2S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione.
| Compound Name | (1S,2S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
|---|---|
| PubChem CID | 10126601 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (1S,2S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-14-methylidene-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
| SMILES | C=C1CC[C@@]23OC(=O)C[C@@]12[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C(=O)OC[C@@]31C |
| InChI | InChI=1S/C21H32O5Si/c1-13-9-10-21-18(5)12-24-16(23)19(18,6)15(20(13,21)11-14(22)25-21)26-27(7,8)17(2,3)4/h15H,1,9-12H2,2-8H3/t15-,18+,19-,20-,21-/m0/s1 |
| InChIKey | HOOHBGMGSGBXOZ-YSCIFQABSA-N |
| XLogP | 3.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|