C10H10F7N — CID 101266096
1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)piperidine (PubChem CID 101266096) has the molecular formula C10H10F7N and a molecular weight of 277.18 g/mol. Its IUPAC name is 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)piperidine.
| Compound Name | 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)piperidine |
|---|---|
| PubChem CID | 101266096 |
| Molecular Formula | C10H10F7N |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)piperidine |
| SMILES | FC1=C(N2CCCCC2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H10F7N/c11-6-7(18-4-2-1-3-5-18)9(14,15)10(16,17)8(6,12)13/h1-5H2 |
| InChIKey | HXXGFJQDZDHQMD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|