C20H20F3NO2 — CID 101266417
(3S,4R,5S)-3-(benzhydrylamino)-4,5-dimethyl-3-(trifluoromethyl)oxolan-2-one (PubChem CID 101266417) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is (3S,4R,5S)-3-(benzhydrylamino)-4,5-dimethyl-3-(trifluoromethyl)oxolan-2-one.
| Compound Name | (3S,4R,5S)-3-(benzhydrylamino)-4,5-dimethyl-3-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 101266417 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (3S,4R,5S)-3-(benzhydrylamino)-4,5-dimethyl-3-(trifluoromethyl)oxolan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@](NC(c2ccccc2)c2ccccc2)(C(F)(F)F)[C@H]1C |
| InChI | InChI=1S/C20H20F3NO2/c1-13-14(2)26-18(25)19(13,20(21,22)23)24-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,17,24H,1-2H3/t13-,14-,19-/m0/s1 |
| InChIKey | IDUXURRFZUPXMK-NJSLBKSFSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |