methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate

C10H15NO2 — CID 101266480

IUPACmethyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate
SMILESC/C=C/C1=CCCCN1C(=O)OC
InChIInChI=1S/C10H15NO2/c1-3-6-9-7-4-5-8-11(9)10(12)13-2/h3,6-7H,4-5,8H2,1-2H3/b6-3+
InChIKeyNEROSFGZRABWCD-ZZXKWVIFSA-N
MW181.24 g/mol
LogP2.31
Rot. Bonds1

About methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate

methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 101266480) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate.

Molecular Properties

Compound Namemethyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate
PubChem CID101266480
Molecular FormulaC10H15NO2
Molecular Weight181.24 g/mol
Exact Mass181.11
IUPAC Namemethyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate
SMILESC/C=C/C1=CCCCN1C(=O)OC
InChIInChI=1S/C10H15NO2/c1-3-6-9-7-4-5-8-11(9)10(12)13-2/h3,6-7H,4-5,8H2,1-2H3/b6-3+
InChIKeyNEROSFGZRABWCD-ZZXKWVIFSA-N
XLogP2.31
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.24
LogP ≤ 52.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate (CID 101266480) is methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate is C/C=C/C1=CCCCN1C(=O)OC.
What is the InChIKey of methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is NEROSFGZRABWCD-ZZXKWVIFSA-N. The full InChI is InChI=1S/C10H15NO2/c1-3-6-9-7-4-5-8-11(9)10(12)13-2/h3,6-7H,4-5,8H2,1-2H3/b6-3+.
What are the key properties of methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate?
methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 181.24 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(E)-prop-1-enyl]-3,4-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 101266480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).