C26H33Cl3FNO2Si — CID 101266503
N-[(Z,3S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-6-methylhept-4-en-3-yl]-2,2,2-trichloroacetamide (PubChem CID 101266503) has the molecular formula C26H33Cl3FNO2Si and a molecular weight of 545.00 g/mol. Its IUPAC name is N-[(Z,3S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-6-methylhept-4-en-3-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(Z,3S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-6-methylhept-4-en-3-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 101266503 |
| Molecular Formula | C26H33Cl3FNO2Si |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | N-[(Z,3S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-6-methylhept-4-en-3-yl]-2,2,2-trichloroacetamide |
| SMILES | CC[C@H](NC(=O)C(Cl)(Cl)Cl)/C(F)=C/[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H33Cl3FNO2Si/c1-6-23(31-24(32)26(27,28)29)22(30)17-19(2)18-33-34(25(3,4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-17,19,23H,6,18H2,1-5H3,(H,31,32)/b22-17-/t19-,23+/m1/s1 |
| InChIKey | KOEOIAGLZOVSDM-GNXUCTDYSA-N |
| XLogP | 6.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|